cas: 957062-72-5 — see every product listed under this CAS number, including other names
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate, 96% (CAS 957062-72-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049748-250MG |
| cas | 957062-72-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1221.46 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 4402.63 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 957062-72-5) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: ZZABXPYOKWIHHV-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | ZZABXPYOKWIHHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)C(=O)OC |
Computed by PubChem (NCBI)