cas: 24477-92-7 — see every product listed under this CAS number, including other names
Methyl 4-(4-aminophenoxy)benzoate, 97%, 97% (CAS 24477-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGYT-100mg |
| cas | 24477-92-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 1230.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4-aminophenoxy)benzoate (CAS 24477-92-7) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 4-(4-aminophenoxy)benzoate. InChIKey: DKBOFXZTTWKXQL-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 4-(4-aminophenoxy)benzoate |
| InChIKey | DKBOFXZTTWKXQL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)