CAS 371756-61-5 appears in our catalog under these names: 3-[3-(Dimethylamino)acryloyl]-2h-chromen-2-one, 95%, 3-(3-(DImethylamino)acryloyl)-2h-chromen-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(E)-3-(dimethylamino)prop-2-enoyl]chromen-2-one (CAS 371756-61-5) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 3-[(E)-3-(dimethylamino)prop-2-enoyl]chromen-2-one. InChIKey: CKYBZVNQBVXTKP-BQYQJAHWSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 3-[(E)-3-(dimethylamino)prop-2-enoyl]chromen-2-one |
| InChIKey | CKYBZVNQBVXTKP-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC2=CC=CC=C2OC1=O |
Computed by PubChem (NCBI)