CAS 409353-81-7 appears in our catalog under these names: 1-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-1h-pyrrole-3-carbaldehyde, 95%, 1-Benzo(1,3)dioxol-5-yl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole-3-carbaldehyde (CAS 409353-81-7) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole-3-carbaldehyde. InChIKey: QPFVKFZJNJFLCL-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole-3-carbaldehyde |
| InChIKey | QPFVKFZJNJFLCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC3=C(C=C2)OCO3)C)C=O |
Computed by PubChem (NCBI)