Products 6277-60-7
CAS 6277-60-7 appears in our catalog under these names: [(1-Naphthylacetyl)amino]acetic acid, 95%, 2-(2-(Naphthalen-1-yl)acetamido)acetic acid, 97%, 2-(2-(Naphthalen-1-yl)acetamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-[(2-naphthalen-1-ylacetyl)amino]acetic acid (CAS 6277-60-7) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 2-[(2-naphthalen-1-ylacetyl)amino]acetic acid. InChIKey: BMZHJBUIQBHUPO-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 2-[(2-naphthalen-1-ylacetyl)amino]acetic acid |
| InChIKey | BMZHJBUIQBHUPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)NCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[2-(naphthalen-1-yl)acetamido]acetic acid, 2-(2-(Naphthalen-1-yl)acetamido)acetic acid, [(1-naphthylacetyl)amino]acetic acid, 2-[(2-naphthalen-1-ylacetyl)amino]acetic acid, 1-naphthylacetylglycine, 2-(2-(Naphthalen-1-yl)acetamido)aceticacid, N-[1-Hydroxy-2-(naphthalen-1-yl)ethylidene]glycine