Products 2682115-61-1
CAS 2682115-61-1 is the registry number for Methyl 4-(4-methylbenzoyl)-1H-pyrrole-2-carboxylate, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 4-(4-methylbenzoyl)-1H-pyrrole-2-carboxylate (CAS 2682115-61-1) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 4-(4-methylbenzoyl)-1H-pyrrole-2-carboxylate. InChIKey: JPWHGOGUUDHOAF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 4-(4-methylbenzoyl)-1H-pyrrole-2-carboxylate |
| InChIKey | JPWHGOGUUDHOAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CNC(=C2)C(=O)OC |
Computed by PubChem (NCBI)