cas: 53355-29-6 — see every product listed under this CAS number, including other names
Methyl 4-(5-formylfuran-2-yl)benzoate 95% (CAS 53355-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150106-100mg |
| cas | 53355-29-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150106 |
Methyl 4-(5-formylfuran-2-yl)benzoate (CAS 53355-29-6) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: methyl 4-(5-formylfuran-2-yl)benzoate. InChIKey: JHCPIIVQUDGETN-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | methyl 4-(5-formylfuran-2-yl)benzoate |
| InChIKey | JHCPIIVQUDGETN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)