cas: 554407-47-5 — see every product listed under this CAS number, including other names
Methyl 4-(nicotinamidomethyl)benzoate (CAS 554407-47-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F774545-250MG |
| cas | 554407-47-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 752.88 Pln | |
| Fluorochem | 1g | 1815.00 Pln | |
| Fluorochem | 5g | 4787.92 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-[(pyridine-3-carbonylamino)methyl]benzoate (CAS 554407-47-5) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: methyl 4-[(pyridine-3-carbonylamino)methyl]benzoate. InChIKey: OQTNVKCWFAMPFG-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | methyl 4-[(pyridine-3-carbonylamino)methyl]benzoate |
| InChIKey | OQTNVKCWFAMPFG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CNC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)