CAS 389081-33-8 is the registry number for 2-(3,4-Dimethoxyphenyl)-1,3-benzoxazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-amine (CAS 389081-33-8) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-amine. InChIKey: WXHYQSJGVYVZKK-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-amine |
| InChIKey | WXHYQSJGVYVZKK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=C(O2)C=CC(=C3)N)OC |
Computed by PubChem (NCBI)