Products 1282145-15-6

CAS 1282145-15-6 is the registry number for 2-Ethyl-9-methyl-1-oxo-2,9-dihydro-1h-beta-carboline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-ethyl-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid (CAS 1282145-15-6) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 2-ethyl-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid. InChIKey: JXWCGCWWBQOVIG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2O3
Molecular weight270.28 g/mol
IUPAC name2-ethyl-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxylic acid
InChIKeyJXWCGCWWBQOVIG-UHFFFAOYSA-N
SMILESCCN1C=C(C2=C(C1=O)N(C3=CC=CC=C32)C)C(=O)O

Computed by PubChem (NCBI)