CAS 1355247-57-2 is the registry number for N,N-Dimethyl-4-(4-nitrophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N,N-dimethyl-4-(4-nitrophenyl)benzamide (CAS 1355247-57-2) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: N,N-dimethyl-4-(4-nitrophenyl)benzamide. InChIKey: APWFZQLXDYPYGH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | N,N-dimethyl-4-(4-nitrophenyl)benzamide |
| InChIKey | APWFZQLXDYPYGH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)