cas: 1427361-33-8 — see every product listed under this CAS number, including other names
Methyl 4-Amino-3-bromo-2-methylbenzoate, 98% (CAS 1427361-33-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A304414-25g |
| cas | 1427361-33-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 8448.37 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1502.61 Pln | |
| Fluorochem | 10g | 2668.87 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-amino-3-bromo-2-methylbenzoate (CAS 1427361-33-8) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl 4-amino-3-bromo-2-methylbenzoate. InChIKey: HAEHULSXXMHFJM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl 4-amino-3-bromo-2-methylbenzoate |
| InChIKey | HAEHULSXXMHFJM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Br)N)C(=O)OC |
Computed by PubChem (NCBI)