cas: 135484-83-2 — see every product listed under this CAS number, including other names
Methyl 4-Bromo-2-aminobenzoate, 97% (CAS 135484-83-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066737-1G |
| cas | 135484-83-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 471.73 Pln | |
| Fluorochem | 500g | 2132.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-amino-4-bromobenzoate (CAS 135484-83-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 2-amino-4-bromobenzoate. InChIKey: MMSODGJNFCCKAZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 2-amino-4-bromobenzoate |
| InChIKey | MMSODGJNFCCKAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)N |
Computed by PubChem (NCBI)