Products 135484-83-2
CAS 135484-83-2 appears in our catalog under these names: Methyl 2-amino-4-bromobenzoate, Methyl 2-amino-4-bromobenzoate, 98%, Methyl 2-amino-4-bromobenzoate 97%, Methyl 4-Bromo-2-aminobenzoate, 97%, 2–Amino–4–bromobenzoic Acid Methyl Ester. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, GLPBio. Available pack sizes: 50g, 100g, 250g, 25g, 500g, 5g, 1g, 1000g.
Methyl 2-amino-4-bromobenzoate (CAS 135484-83-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 2-amino-4-bromobenzoate. InChIKey: MMSODGJNFCCKAZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 2-amino-4-bromobenzoate |
| InChIKey | MMSODGJNFCCKAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)N |
Computed by PubChem (NCBI)