cas: 256935-85-0 — see every product listed under this CAS number, including other names
Methyl 4-amino-2-chloro-5-iodobenzoate 98% (CAS 256935-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A791839-100mg |
| cas | 256935-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1977.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A791839 |
Methyl 4-amino-2-chloro-5-iodobenzoate (CAS 256935-85-0) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: methyl 4-amino-2-chloro-5-iodobenzoate. InChIKey: ACKIVQFMUDRNPN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | methyl 4-amino-2-chloro-5-iodobenzoate |
| InChIKey | ACKIVQFMUDRNPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)N)I |
Computed by PubChem (NCBI)