cas: 46004-37-9 — see every product listed under this CAS number, including other names
Methyl 4-amino-2-chlorobenzoate 97% (CAS 46004-37-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156126-1g |
| cas | 46004-37-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 681.88 Pln | |
| Ambeed | 500g | 2667.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156126 |
Methyl 4-amino-2-chlorobenzoate (CAS 46004-37-9) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 4-amino-2-chlorobenzoate. InChIKey: DSHBGNPOIBSIOQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 4-amino-2-chlorobenzoate |
| InChIKey | DSHBGNPOIBSIOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)