CAS 5202-89-1 appears in our catalog under these names: Methyl 2-amino-5-chlorobenzoate, 98%, Methyl 2–amino–5–chlorobenzoate, Methyl 2-amino-5-chlorobenzoate, 98+% , Methyl 2-amino-5-chlorobenzoate, Methyl 2-Amino-5-chlorobenzoate, >98.0%(GC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 50g, 250g, 1kg.
Methyl 2-amino-5-chlorobenzoate (CAS 5202-89-1) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 2-amino-5-chlorobenzoate. InChIKey: IGHVUURTQGBABT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 2-amino-5-chlorobenzoate |
| InChIKey | IGHVUURTQGBABT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N |
Computed by PubChem (NCBI)