cas: 1824127-03-8 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-(methylthio)benzoate (CAS 1824127-03-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629300-100MG |
| cas | 1824127-03-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 6344.66 Pln | |
| Fluorochem | 250mg | 8182.55 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-bromo-2-methylsulfanylbenzoate (CAS 1824127-03-8) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: methyl 4-bromo-2-methylsulfanylbenzoate. InChIKey: YJLVEWVNFFFEAF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | methyl 4-bromo-2-methylsulfanylbenzoate |
| InChIKey | YJLVEWVNFFFEAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)SC |
Computed by PubChem (NCBI)