cas: 877149-10-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-chloro-6-methylbenzoate 98% (CAS 877149-10-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A360616-100mg |
| cas | 877149-10-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 10g | 1282.62 Pln | |
| Ambeed | 25g | 2584.25 Pln | |
| Ambeed | 100g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A360616 |
Methyl 4-bromo-2-chloro-6-methylbenzoate (CAS 877149-10-5) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-methylbenzoate. InChIKey: KOVCJLYSMXZNDF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-methylbenzoate |
| InChIKey | KOVCJLYSMXZNDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)Cl)Br |
Computed by PubChem (NCBI)