cas: 877149-10-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-chloro-6-methylbenzoate, 98%, 98% (CAS 877149-10-5) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 1kg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115JCM-250g |
| cas | 877149-10-5 |
| size | 250g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 4850.00 Pln | |
| Chemat | 500g | 9576.00 Pln | |
| Chemat | 1kg | 18856.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1509.20 Pln | |
| Chemat | 50g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2-chloro-6-methylbenzoate (CAS 877149-10-5) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-methylbenzoate. InChIKey: KOVCJLYSMXZNDF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-methylbenzoate |
| InChIKey | KOVCJLYSMXZNDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)Cl)Br |
Computed by PubChem (NCBI)