Methyl 4-bromo-2-fluoro-3-methylbenzoate, 95%
cas: 1206680-27-4 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-fluoro-3-methylbenzoate, 95% (CAS 1206680-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A114770-100mg |
| cas | 1206680-27-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 564.27 Pln | |
| BLDpharm | 5g | 2124.83 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-bromo-2-fluoro-3-methylbenzoate (CAS 1206680-27-4) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-3-methylbenzoate. InChIKey: BFWXLPUXNQYBML-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-3-methylbenzoate |
| InChIKey | BFWXLPUXNQYBML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)C(=O)OC)Br |
Computed by PubChem (NCBI)