CAS 432022-88-3 appears in our catalog under these names: Methyl 4-Bromo-3,5-dimethylbenzoate, >95% (HPLC), Methyl 4–bromo–3,5–dimethylbenzoate, Methyl 4-bromo-3,5-dimethylbenzoate, 97%, 97%, Methyl 4-bromo-3,5-dimethylbenzoate, 95%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 100g, 100mg, 25g.
Methyl 4-bromo-3,5-dimethylbenzoate (CAS 432022-88-3) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 4-bromo-3,5-dimethylbenzoate. InChIKey: TZQNPDBABLCTGL-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 4-bromo-3,5-dimethylbenzoate |
| InChIKey | TZQNPDBABLCTGL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(=O)OC |
Computed by PubChem (NCBI)