cas: 1331943-86-2 — see every product listed under this CAS number, including other names
Methyl 4-bromo-3-(difluoromethoxy)benzoate 97% (CAS 1331943-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A875819-100mg |
| cas | 1331943-86-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2244.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A875819 |
Methyl 4-bromo-3-(difluoromethoxy)benzoate (CAS 1331943-86-2) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: methyl 4-bromo-3-(difluoromethoxy)benzoate. InChIKey: KSFBNYJPZAQHMC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | methyl 4-bromo-3-(difluoromethoxy)benzoate |
| InChIKey | KSFBNYJPZAQHMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OC(F)F |
Computed by PubChem (NCBI)