Products 705279-03-4
CAS 705279-03-4 is the registry number for Benzoic acid, 2-bromo-5-(difluoromethoxy)-, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-bromo-5-(difluoromethoxy)benzoate (CAS 705279-03-4) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: methyl 2-bromo-5-(difluoromethoxy)benzoate. InChIKey: UECTUFPIUZYTQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | methyl 2-bromo-5-(difluoromethoxy)benzoate |
| InChIKey | UECTUFPIUZYTQW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC(F)F)Br |
Computed by PubChem (NCBI)