cas: 1206250-28-3 — see every product listed under this CAS number, including other names
Methyl 4-chloro-6-methylpicolinate 95% (CAS 1206250-28-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A566766-100mg |
| cas | 1206250-28-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2061.38 Pln | |
| Ambeed | 250mg | 3997.12 Pln | |
| Ambeed | 1g | 11067.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A566766 |
Methyl 4-chloro-6-methylpyridine-2-carboxylate (CAS 1206250-28-3) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 4-chloro-6-methylpyridine-2-carboxylate. InChIKey: KAQXLVOZAVBDRT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 4-chloro-6-methylpyridine-2-carboxylate |
| InChIKey | KAQXLVOZAVBDRT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)C(=O)OC)Cl |
Computed by PubChem (NCBI)