CAS 1033997-01-1 appears in our catalog under these names: Methyl 4-cyano-3-nitrobenzoate, 98%, 98%, Methyl 4-cyano-3-nitrobenzoate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-cyano-3-nitrobenzoate (CAS 1033997-01-1) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: methyl 4-cyano-3-nitrobenzoate. InChIKey: PSZYWMHNXWCCLS-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | methyl 4-cyano-3-nitrobenzoate |
| InChIKey | PSZYWMHNXWCCLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)