Methyl 4-hydroxy-7-(trifluoromethyl)quinoline-2-carboxylate, 98%
cas: 1072944-69-4 — see every product listed under this CAS number, including other names
Methyl 4-hydroxy-7-(trifluoromethyl)quinoline-2-carboxylate, 98% (CAS 1072944-69-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A338739-250mg |
| cas | 1072944-69-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 10g | 747.54 Pln | |
| Fluorochem | 1g | 492.55 Pln | |
| Fluorochem | 250mg | 232.23 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate (CAS 1072944-69-4) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate. InChIKey: HXMSYFTWUSYAPH-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO3 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate |
| InChIKey | HXMSYFTWUSYAPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)