Products 1072944-69-4
CAS 1072944-69-4 is the registry number for Methyl 4-hydroxy-7-(trifluoromethyl)quinoline-2-carboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
Methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate (CAS 1072944-69-4) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate. InChIKey: HXMSYFTWUSYAPH-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO3 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | methyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylate |
| InChIKey | HXMSYFTWUSYAPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)