CAS 1140626-83-0 is the registry number for 5-Methyl-2-(2-(trifluoromethyl)phenyl)oxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid (CAS 1140626-83-0) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: 5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid. InChIKey: POBHCJJULRAHMD-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO3 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | POBHCJJULRAHMD-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)