Products 1140626-83-0

CAS 1140626-83-0 is the registry number for 5-Methyl-2-(2-(trifluoromethyl)phenyl)oxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid (CAS 1140626-83-0) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: 5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid. InChIKey: POBHCJJULRAHMD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F3NO3
Molecular weight271.19 g/mol
IUPAC name5-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid
InChIKeyPOBHCJJULRAHMD-UHFFFAOYSA-N
SMILESCC1=C(N=C(O1)C2=CC=CC=C2C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)