CAS 668970-86-3 is the registry number for Methyl 5-(2-(trifluoromethyl)phenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylate (CAS 668970-86-3) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: methyl 5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylate. InChIKey: OYSFTWWQUFIVGG-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO3 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | methyl 5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylate |
| InChIKey | OYSFTWWQUFIVGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)