cas: 576170-42-8 — see every product listed under this CAS number, including other names
Methyl 4-methoxy-3-(trifluoromethyl)benzoate (CAS 576170-42-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F101429-1G |
| cas | 576170-42-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1445.34 Pln | |
| Fluorochem | 5g | 4199.58 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-methoxy-3-(trifluoromethyl)benzoate (CAS 576170-42-8) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: methyl 4-methoxy-3-(trifluoromethyl)benzoate. InChIKey: FAOOKWQMNNMWGW-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | methyl 4-methoxy-3-(trifluoromethyl)benzoate |
| InChIKey | FAOOKWQMNNMWGW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)