cas: 72922-61-3 — see every product listed under this CAS number, including other names
Methyl 4-nitro-1H-indazole-6-carboxylate 97% (CAS 72922-61-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A788993-100mg |
| cas | 72922-61-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 414.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A788993 |
Methyl 4-nitro-1H-indazole-6-carboxylate (CAS 72922-61-3) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 4-nitro-1H-indazole-6-carboxylate. InChIKey: OIJKWHSNBQFGHC-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 4-nitro-1H-indazole-6-carboxylate |
| InChIKey | OIJKWHSNBQFGHC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=NN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)