cas: 13138-74-4 — see every product listed under this CAS number, including other names
Methyl 4-nitro-1H-pyrrole-2-carboxylate, 98%, 98% (CAS 13138-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W3M-100mg |
| cas | 13138-74-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 794.00 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-nitro-1H-pyrrole-2-carboxylate (CAS 13138-74-4) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: methyl 4-nitro-1H-pyrrole-2-carboxylate. InChIKey: BRZNAATZQZPGBQ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | methyl 4-nitro-1H-pyrrole-2-carboxylate |
| InChIKey | BRZNAATZQZPGBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)