cas: 13138-74-4 — see every product listed under this CAS number, including other names
Methyl 4-nitro-1H-pyrrole-2-carboxylate, 98% (CAS 13138-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603385-100MG |
| cas | 13138-74-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 500mg | 846.59 Pln | |
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 2580.36 Pln | |
| Fluorochem | 10g | 4949.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-nitro-1H-pyrrole-2-carboxylate (CAS 13138-74-4) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: methyl 4-nitro-1H-pyrrole-2-carboxylate. InChIKey: BRZNAATZQZPGBQ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | methyl 4-nitro-1H-pyrrole-2-carboxylate |
| InChIKey | BRZNAATZQZPGBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)