cas: 2070896-62-5 — see every product listed under this CAS number, including other names
Methyl 5,6-Bis(benzyloxy)nicotinate, ≥97%, ≥97% (CAS 2070896-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEME-1g |
| cas | 2070896-62-5 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 6885.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5,6-bis(phenylmethoxy)pyridine-3-carboxylate (CAS 2070896-62-5) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: methyl 5,6-bis(phenylmethoxy)pyridine-3-carboxylate. InChIKey: PSVCTQIHBPBAMT-UHFFFAOYSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | methyl 5,6-bis(phenylmethoxy)pyridine-3-carboxylate |
| InChIKey | PSVCTQIHBPBAMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)