cas: 1375064-47-3 — see every product listed under this CAS number, including other names
Methyl 5-(2-Thiazolyl)isoxazole-3-carboxylate, >97%, >97% (CAS 1375064-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124FB-100mg |
| cas | 1375064-47-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1216.40 Pln | |
| Chemat | 5g | 3395.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylate (CAS 1375064-47-3) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: methyl 5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylate. InChIKey: OJDXFHLYVJEQMK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | methyl 5-(1,3-thiazol-2-yl)-1,2-oxazole-3-carboxylate |
| InChIKey | OJDXFHLYVJEQMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=NC=CS2 |
Computed by PubChem (NCBI)