cas: 668970-74-9 — see every product listed under this CAS number, including other names
Methyl 5-(2-fluorophenyl)isoxazole-3-carboxylate, 97% (CAS 668970-74-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A299472-10g |
| cas | 668970-74-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12595.24 Pln | |
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 500mg | 1195.43 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 2.5g | 3371.75 Pln | |
| Fluorochem | 5g | 4793.12 Pln | |
| Fluorochem | 10g | 7849.34 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS 668970-74-9) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: UJELOQIDIAROPA-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | UJELOQIDIAROPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=CC=C2F |
Computed by PubChem (NCBI)