CAS 1956331-12-6 is the registry number for Methyl 6-fluoro-4-oxo-3,4-dihydroquinoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 6-fluoro-4-oxo-3H-quinoline-2-carboxylate (CAS 1956331-12-6) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: methyl 6-fluoro-4-oxo-3H-quinoline-2-carboxylate. InChIKey: UPHATIULRLLAIL-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl 6-fluoro-4-oxo-3H-quinoline-2-carboxylate |
| InChIKey | UPHATIULRLLAIL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=C(C=C2)F)C(=O)C1 |
Computed by PubChem (NCBI)