CAS 1736-20-5 is the registry number for 3-(2-Fluorophenyl)-5-methylisoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1736-20-5) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: ZSDKQOQGZGDHNC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | ZSDKQOQGZGDHNC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)