CAS 1351788-61-8 is the registry number for 6-Fluoro-4-methoxyquinoline-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-fluoro-4-methoxyquinoline-2-carboxylic acid (CAS 1351788-61-8) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 6-fluoro-4-methoxyquinoline-2-carboxylic acid. InChIKey: PQKANOYXHMMLCC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 6-fluoro-4-methoxyquinoline-2-carboxylic acid |
| InChIKey | PQKANOYXHMMLCC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)