cas: 676501-89-6 — see every product listed under this CAS number, including other names
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate 98% (CAS 676501-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A617405-250mg |
| cas | 676501-89-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A617405 |
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate (CAS 676501-89-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate. InChIKey: FRSWTKGVRPGQPF-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate |
| InChIKey | FRSWTKGVRPGQPF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(N2)C(=O)OC |
Computed by PubChem (NCBI)