cas: 1610705-51-5 — see every product listed under this CAS number, including other names
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate 98% (CAS 1610705-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A929640-100mg |
| cas | 1610705-51-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1043.44 Pln | |
| Ambeed | 25g | 4208.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A929640 |
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate (CAS 1610705-51-5) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate. InChIKey: OMKFGJOPZQLNCN-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
| InChIKey | OMKFGJOPZQLNCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(=O)OC |
Computed by PubChem (NCBI)