cas: 916138-13-1 — see every product listed under this CAS number, including other names
Methyl 5-(4,4,5-trimethyl-[1,3,2]dioxaborolan-2-yl)thiophene-2-carboxylate, 98% (CAS 916138-13-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225111-5G |
| cas | 916138-13-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 4012.15 Pln | |
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1502.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 916138-13-1) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: LMWIOYXSRDMVLD-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | LMWIOYXSRDMVLD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(=O)OC |
Computed by PubChem (NCBI)