cas: 425609-97-8 — see every product listed under this CAS number, including other names
Methyl 5-(4-methoxyphenyl)isoxazole-3-carboxylate, 97% (CAS 425609-97-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A701173-5g |
| cas | 425609-97-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8559.04 Pln | |
| AmBeed | 10g | 12803.56 Pln | |
| AmBeed | 25g | 15479.17 Pln | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 500mg | 351.98 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 2.5g | 695.61 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1367.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate (CAS 425609-97-8) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: methyl 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate. InChIKey: LSTUYMFZYOAFGT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | methyl 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | LSTUYMFZYOAFGT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NO2)C(=O)OC |
Computed by PubChem (NCBI)