cas: 1036389-86-2 — see every product listed under this CAS number, including other names
Methyl 5-Amino-2-bromo-4-fluorobenzoate, 97%, 97% (CAS 1036389-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119W8U-100mg |
| cas | 1036389-86-2 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1130.00 Pln | |
| Chemat | 5g | 3515.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-amino-2-bromo-4-fluorobenzoate (CAS 1036389-86-2) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: methyl 5-amino-2-bromo-4-fluorobenzoate. InChIKey: QMTDDCURRBENGD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | methyl 5-amino-2-bromo-4-fluorobenzoate |
| InChIKey | QMTDDCURRBENGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)F)N |
Computed by PubChem (NCBI)