cas: 1036389-86-2 — see every product listed under this CAS number, including other names
Methyl 5-amino-2-bromo-4-fluorobenzoate, 97% (CAS 1036389-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637650-100MG |
| cas | 1036389-86-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1476.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-amino-2-bromo-4-fluorobenzoate (CAS 1036389-86-2) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: methyl 5-amino-2-bromo-4-fluorobenzoate. InChIKey: QMTDDCURRBENGD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | methyl 5-amino-2-bromo-4-fluorobenzoate |
| InChIKey | QMTDDCURRBENGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)F)N |
Computed by PubChem (NCBI)