cas: 1211538-72-5 — see every product listed under this CAS number, including other names
Methyl 5-Bromo-3-Fluoropicolinate, 97%, 97% (CAS 1211538-72-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110CUQ-100mg |
| cas | 1211538-72-5 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 500mg | 160.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 914.00 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 5435.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-3-fluoropyridine-2-carboxylate (CAS 1211538-72-5) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: methyl 5-bromo-3-fluoropyridine-2-carboxylate. InChIKey: UWDDDYSSTSVUJK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | methyl 5-bromo-3-fluoropyridine-2-carboxylate |
| InChIKey | UWDDDYSSTSVUJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)Br)F |
Computed by PubChem (NCBI)