cas: 26028-36-4 — see every product listed under this CAS number, including other names
Methyl 5-bromobenzofuran-2-carboxylate 98% (CAS 26028-36-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A886419-100mg |
| cas | 26028-36-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 1388.31 Pln | |
| Ambeed | 10g | 2417.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A886419 |
Methyl 5-bromo-1-benzofuran-2-carboxylate (CAS 26028-36-4) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: methyl 5-bromo-1-benzofuran-2-carboxylate. InChIKey: ZZDBMDNRQQDSKG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | methyl 5-bromo-1-benzofuran-2-carboxylate |
| InChIKey | ZZDBMDNRQQDSKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)