cas: 103261-68-3 — see every product listed under this CAS number, including other names
Methyl 5-cyano-2-methylbenzoate 95% (CAS 103261-68-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345274-250mg |
| cas | 103261-68-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 314.75 Pln | |
| Ambeed | 10g | 476.06 Pln | |
| Ambeed | 25g | 1082.38 Pln | |
| Ambeed | 100g | 4108.38 Pln | |
| Ambeed | 500g | 16223.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A345274 |
Methyl 5-cyano-2-methylbenzoate (CAS 103261-68-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 5-cyano-2-methylbenzoate. InChIKey: NLJITVMSLMNYSZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 5-cyano-2-methylbenzoate |
| InChIKey | NLJITVMSLMNYSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#N)C(=O)OC |
Computed by PubChem (NCBI)