Methyl 5-methoxybenzo[d]oxazole-2-carboxylate, 98%
cas: 49559-57-1 — see every product listed under this CAS number, including other names
Methyl 5-methoxybenzo[d]oxazole-2-carboxylate, 98% (CAS 49559-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A760576-100mg |
| cas | 49559-57-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1071.25 Pln | |
| Ambeed | 5g | 3351.88 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 480.97 Pln | |
| BLDpharm | 1g | 1141.84 Pln | |
| BLDpharm | 5g | 3602.09 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 2781.20 Pln | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 461.31 Pln | |
| Fluorochem | 1g | 1106.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 5-methoxy-1,3-benzoxazole-2-carboxylate (CAS 49559-57-1) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 5-methoxy-1,3-benzoxazole-2-carboxylate. InChIKey: MGZDRAKFWQDAIR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 5-methoxy-1,3-benzoxazole-2-carboxylate |
| InChIKey | MGZDRAKFWQDAIR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=N2)C(=O)OC |
Computed by PubChem (NCBI)